C11H15FN2 — CID 55296025
2-cyclopropyl-1-(6-fluoro-2-methyl-3-pyridinyl)ethanamine (PubChem CID 55296025) has the molecular formula C11H15FN2 and a molecular weight of 194.25 g/mol. Its IUPAC name is 2-cyclopropyl-1-(6-fluoro-2-methyl-3-pyridinyl)ethanamine.
| Compound Name | 2-cyclopropyl-1-(6-fluoro-2-methyl-3-pyridinyl)ethanamine |
|---|---|
| PubChem CID | 55296025 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 2-cyclopropyl-1-(6-fluoro-2-methyl-3-pyridinyl)ethanamine |
| SMILES | Cc1nc(F)ccc1C(N)CC1CC1 |
| InChI | InChI=1S/C11H15FN2/c1-7-9(4-5-11(12)14-7)10(13)6-8-2-3-8/h4-5,8,10H,2-3,6,13H2,1H3 |
| InChIKey | FCLCYDAEGZWGSE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|