C7H9NO2 — CID 55303808
4-buta-1,3-dien-2-yloxyazetidin-2-one (PubChem CID 55303808) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is 4-buta-1,3-dien-2-yloxyazetidin-2-one.
| Compound Name | 4-buta-1,3-dien-2-yloxyazetidin-2-one |
|---|---|
| PubChem CID | 55303808 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 4-buta-1,3-dien-2-yloxyazetidin-2-one |
| SMILES | C=CC(=C)OC1CC(=O)N1 |
| InChI | InChI=1S/C7H9NO2/c1-3-5(2)10-7-4-6(9)8-7/h3,7H,1-2,4H2,(H,8,9) |
| InChIKey | ZNEGFGTYBIKIRQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|