C21H24O6 — CID 55306738
[2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-(3-methylphenoxy)butanoate (PubChem CID 55306738) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-(3-methylphenoxy)butanoate.
| Compound Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-(3-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 55306738 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-2-oxoethyl] 4-(3-methylphenoxy)butanoate |
| SMILES | COc1ccc(C(=O)COC(=O)CCCOc2cccc(C)c2)cc1OC |
| InChI | InChI=1S/C21H24O6/c1-15-6-4-7-17(12-15)26-11-5-8-21(23)27-14-18(22)16-9-10-19(24-2)20(13-16)25-3/h4,6-7,9-10,12-13H,5,8,11,14H2,1-3H3 |
| InChIKey | XRKVTEZCBTTWTM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|