C18H15N3O7S — CID 55308525
[2-[N-(cyanomethyl)anilino]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate (PubChem CID 55308525) has the molecular formula C18H15N3O7S and a molecular weight of 417.40 g/mol. Its IUPAC name is [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate.
| Compound Name | [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 55308525 |
| Molecular Formula | C18H15N3O7S |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate |
| SMILES | CS(=O)(=O)c1ccc(C(=O)OCC(=O)N(CC#N)c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H15N3O7S/c1-29(26,27)16-8-7-13(11-15(16)21(24)25)18(23)28-12-17(22)20(10-9-19)14-5-3-2-4-6-14/h2-8,11H,10,12H2,1H3 |
| InChIKey | NBWRDNBDGHMGLD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 147.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|