C16H17BrO4 — CID 55313110
(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl cyclohex-3-ene-1-carboxylate (PubChem CID 55313110) has the molecular formula C16H17BrO4 and a molecular weight of 353.21 g/mol. Its IUPAC name is (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl cyclohex-3-ene-1-carboxylate.
| Compound Name | (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 55313110 |
| Molecular Formula | C16H17BrO4 |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl cyclohex-3-ene-1-carboxylate |
| SMILES | O=C(OCc1cc2c(cc1Br)OCCO2)C1CC=CCC1 |
| InChI | InChI=1S/C16H17BrO4/c17-13-9-15-14(19-6-7-20-15)8-12(13)10-21-16(18)11-4-2-1-3-5-11/h1-2,8-9,11H,3-7,10H2 |
| InChIKey | XCJKRKXAYWVXAR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|