About (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl cyclohex-3-ene-1-carboxylate
(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl cyclohex-3-ene-1-carboxylate (PubChem CID 55313110) has the molecular formula C16H17BrO4
and a molecular weight of 353.21 g/mol. Its IUPAC name is (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl cyclohex-3-ene-1-carboxylate.
Molecular Properties
| Compound Name | (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl cyclohex-3-ene-1-carboxylate |
| PubChem CID | 55313110 |
| Molecular Formula | C16H17BrO4 |
| Molecular Weight | 353.21 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl cyclohex-3-ene-1-carboxylate |
| SMILES | O=C(OCc1cc2c(cc1Br)OCCO2)C1CC=CCC1 |
| InChI | InChI=1S/C16H17BrO4/c17-13-9-15-14(19-6-7-20-15)8-12(13)10-21-16(18)11-4-2-1-3-5-11/h1-2,8-9,11H,3-7,10H2 |
| InChIKey | XCJKRKXAYWVXAR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.21 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl cyclohex-3-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl cyclohex-3-ene-1-carboxylate?
The IUPAC name of (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl cyclohex-3-ene-1-carboxylate (CID 55313110) is (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl cyclohex-3-ene-1-carboxylate.
What is the SMILES notation for (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl cyclohex-3-ene-1-carboxylate?
The canonical SMILES for (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl cyclohex-3-ene-1-carboxylate is O=C(OCc1cc2c(cc1Br)OCCO2)C1CC=CCC1.
What is the InChIKey of (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl cyclohex-3-ene-1-carboxylate?
The InChIKey is XCJKRKXAYWVXAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17BrO4/c17-13-9-15-14(19-6-7-20-15)8-12(13)10-21-16(18)11-4-2-1-3-5-11/h1-2,8-9,11H,3-7,10H2.
What are the key properties of (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl cyclohex-3-ene-1-carboxylate?
(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl cyclohex-3-ene-1-carboxylate has a molecular weight of 353.21 g/mol, XLogP of 3.62, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl cyclohex-3-ene-1-carboxylate is sourced from PubChem (CID 55313110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).