C22H30N2O5 — CID 55316063
[2-(dicyclohexylamino)-2-oxoethyl] 2-(2-nitrophenyl)acetate (PubChem CID 55316063) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is [2-(dicyclohexylamino)-2-oxoethyl] 2-(2-nitrophenyl)acetate.
| Compound Name | [2-(dicyclohexylamino)-2-oxoethyl] 2-(2-nitrophenyl)acetate |
|---|---|
| PubChem CID | 55316063 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | [2-(dicyclohexylamino)-2-oxoethyl] 2-(2-nitrophenyl)acetate |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])OCC(=O)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C22H30N2O5/c25-21(16-29-22(26)15-17-9-7-8-14-20(17)24(27)28)23(18-10-3-1-4-11-18)19-12-5-2-6-13-19/h7-9,14,18-19H,1-6,10-13,15-16H2 |
| InChIKey | JYZHMPGPXFHDFC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|