C10H9Cl3O2S — CID 55319076
(5-chlorothiophen-2-yl)methyl 2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 55319076) has the molecular formula C10H9Cl3O2S and a molecular weight of 299.61 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)methyl 2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | (5-chlorothiophen-2-yl)methyl 2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 55319076 |
| Molecular Formula | C10H9Cl3O2S |
| Molecular Weight | 299.61 g/mol |
| Exact Mass | 297.94 |
| IUPAC Name | (5-chlorothiophen-2-yl)methyl 2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | CC1(C(=O)OCc2ccc(Cl)s2)CC1(Cl)Cl |
| InChI | InChI=1S/C10H9Cl3O2S/c1-9(5-10(9,12)13)8(14)15-4-6-2-3-7(11)16-6/h2-3H,4-5H2,1H3 |
| InChIKey | RXJMOOBTFCDIBT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.61 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|