C26H21N3O6 — CID 55319125
[2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 1-amino-9,10-dioxoanthracene-2-carboxylate (PubChem CID 55319125) has the molecular formula C26H21N3O6 and a molecular weight of 471.47 g/mol. Its IUPAC name is [2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 1-amino-9,10-dioxoanthracene-2-carboxylate.
| Compound Name | [2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 1-amino-9,10-dioxoanthracene-2-carboxylate |
|---|---|
| PubChem CID | 55319125 |
| Molecular Formula | C26H21N3O6 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | [2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 1-amino-9,10-dioxoanthracene-2-carboxylate |
| SMILES | CCNC(=O)NC(=O)C(OC(=O)c1ccc2c(c1N)C(=O)c1ccccc1C2=O)c1ccccc1 |
| InChI | InChI=1S/C26H21N3O6/c1-2-28-26(34)29-24(32)23(14-8-4-3-5-9-14)35-25(33)18-13-12-17-19(20(18)27)22(31)16-11-7-6-10-15(16)21(17)30/h3-13,23H,2,27H2,1H3,(H2,28,29,32,34) |
| InChIKey | WUVFIADNDCDGJW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|