C21H30N2O5 — CID 55320204
[2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 2-[(4-butoxybenzoyl)amino]acetate (PubChem CID 55320204) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 2-[(4-butoxybenzoyl)amino]acetate.
| Compound Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 2-[(4-butoxybenzoyl)amino]acetate |
|---|---|
| PubChem CID | 55320204 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 2-[(4-butoxybenzoyl)amino]acetate |
| SMILES | C=C(C)CN(CC)C(=O)COC(=O)CNC(=O)c1ccc(OCCCC)cc1 |
| InChI | InChI=1S/C21H30N2O5/c1-5-7-12-27-18-10-8-17(9-11-18)21(26)22-13-20(25)28-15-19(24)23(6-2)14-16(3)4/h8-11H,3,5-7,12-15H2,1-2,4H3,(H,22,26) |
| InChIKey | FZFMCRDCCIPZGM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|