C23H30N2O4 — CID 55339619
(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl) 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate (PubChem CID 55339619) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is (2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl) 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate.
| Compound Name | (2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl) 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 55339619 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | (2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl) 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate |
| SMILES | CCC1(c2ccccc2)NC(=O)N(CC(=O)OC2CC3CC(C2C)C3(C)C)C1=O |
| InChI | InChI=1S/C23H30N2O4/c1-5-23(15-9-7-6-8-10-15)20(27)25(21(28)24-23)13-19(26)29-18-12-16-11-17(14(18)2)22(16,3)4/h6-10,14,16-18H,5,11-13H2,1-4H3,(H,24,28) |
| InChIKey | QYXUCTCLHKOSAV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|