C21H16ClN5O5S — CID 55340730
N-[2-[(5E)-5-[(4-chloro-3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-5-methylimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 55340730) has the molecular formula C21H16ClN5O5S and a molecular weight of 485.91 g/mol. Its IUPAC name is N-[2-[(5E)-5-[(4-chloro-3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-5-methylimidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-[2-[(5E)-5-[(4-chloro-3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-5-methylimidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 55340730 |
| Molecular Formula | C21H16ClN5O5S |
| Molecular Weight | 485.91 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | N-[2-[(5E)-5-[(4-chloro-3-nitrophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]ethyl]-5-methylimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | Cc1cccc2nc(C(=O)NCCN3C(=O)S/C(=C/c4ccc(Cl)c([N+](=O)[O-])c4)C3=O)cn12 |
| InChI | InChI=1S/C21H16ClN5O5S/c1-12-3-2-4-18-24-15(11-26(12)18)19(28)23-7-8-25-20(29)17(33-21(25)30)10-13-5-6-14(22)16(9-13)27(31)32/h2-6,9-11H,7-8H2,1H3,(H,23,28)/b17-10+ |
| InChIKey | GUVCLUJWZCLFQT-LICLKQGHSA-N |
| XLogP | 3.67 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.91 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|