C21H25N3O4S — CID 55341802
N'-[2-(2,3-dimethylphenoxy)propanoyl]-1-(thiophene-2-carbonyl)pyrrolidine-2-carbohydrazide (PubChem CID 55341802) has the molecular formula C21H25N3O4S and a molecular weight of 415.52 g/mol. Its IUPAC name is N'-[2-(2,3-dimethylphenoxy)propanoyl]-1-(thiophene-2-carbonyl)pyrrolidine-2-carbohydrazide.
| Compound Name | N'-[2-(2,3-dimethylphenoxy)propanoyl]-1-(thiophene-2-carbonyl)pyrrolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 55341802 |
| Molecular Formula | C21H25N3O4S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | N'-[2-(2,3-dimethylphenoxy)propanoyl]-1-(thiophene-2-carbonyl)pyrrolidine-2-carbohydrazide |
| SMILES | Cc1cccc(OC(C)C(=O)NNC(=O)C2CCCN2C(=O)c2cccs2)c1C |
| InChI | InChI=1S/C21H25N3O4S/c1-13-7-4-9-17(14(13)2)28-15(3)19(25)22-23-20(26)16-8-5-11-24(16)21(27)18-10-6-12-29-18/h4,6-7,9-10,12,15-16H,5,8,11H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | MLSXNUIDIOFBGJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|