C19H25NOS — CID 55352300
N-[2-(cyclohexen-1-yl)ethyl]-2-[(E)-3-phenylprop-2-enyl]sulfanylacetamide (PubChem CID 55352300) has the molecular formula C19H25NOS and a molecular weight of 315.48 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-[(E)-3-phenylprop-2-enyl]sulfanylacetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(E)-3-phenylprop-2-enyl]sulfanylacetamide |
|---|---|
| PubChem CID | 55352300 |
| Molecular Formula | C19H25NOS |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-[(E)-3-phenylprop-2-enyl]sulfanylacetamide |
| SMILES | O=C(CSC/C=C/c1ccccc1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C19H25NOS/c21-19(20-14-13-18-10-5-2-6-11-18)16-22-15-7-12-17-8-3-1-4-9-17/h1,3-4,7-10,12H,2,5-6,11,13-16H2,(H,20,21)/b12-7+ |
| InChIKey | KLEPKUSZUUYABT-KPKJPENVSA-N |
| XLogP | 4.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|