C20H24F2N2O2 — CID 55356680
2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-N-phenyl-N-propan-2-ylacetamide (PubChem CID 55356680) has the molecular formula C20H24F2N2O2 and a molecular weight of 362.42 g/mol. Its IUPAC name is 2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-N-phenyl-N-propan-2-ylacetamide.
| Compound Name | 2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-N-phenyl-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 55356680 |
| Molecular Formula | C20H24F2N2O2 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 2-[[4-(difluoromethoxy)phenyl]methyl-methylamino]-N-phenyl-N-propan-2-ylacetamide |
| SMILES | CC(C)N(C(=O)CN(C)Cc1ccc(OC(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H24F2N2O2/c1-15(2)24(17-7-5-4-6-8-17)19(25)14-23(3)13-16-9-11-18(12-10-16)26-20(21)22/h4-12,15,20H,13-14H2,1-3H3 |
| InChIKey | KIVSYGGDGDFOAC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |