C20H19F3N2O3 — CID 55358758
3-pyridin-3-ylpropyl 5-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylate (PubChem CID 55358758) has the molecular formula C20H19F3N2O3 and a molecular weight of 392.38 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl 5-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylate.
| Compound Name | 3-pyridin-3-ylpropyl 5-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 55358758 |
| Molecular Formula | C20H19F3N2O3 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 3-pyridin-3-ylpropyl 5-oxo-1-[3-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylate |
| SMILES | O=C(OCCCc1cccnc1)C1CC(=O)N(c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C20H19F3N2O3/c21-20(22,23)16-6-1-7-17(11-16)25-13-15(10-18(25)26)19(27)28-9-3-5-14-4-2-8-24-12-14/h1-2,4,6-8,11-12,15H,3,5,9-10,13H2 |
| InChIKey | QTELBQSQSKXLBZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|