C26H29ClN4O4 — CID 55365266
N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]acetamide (PubChem CID 55365266) has the molecular formula C26H29ClN4O4 and a molecular weight of 497.00 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]acetamide.
| Compound Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]acetamide |
|---|---|
| PubChem CID | 55365266 |
| Molecular Formula | C26H29ClN4O4 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2-[methyl-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]amino]acetamide |
| SMILES | CN(CC(=O)NCc1ccc(-c2ccc(Cl)cc2)o1)CC(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C26H29ClN4O4/c1-30(18-26(33)29-21-6-8-22(9-7-21)31-12-14-34-15-13-31)17-25(32)28-16-23-10-11-24(35-23)19-2-4-20(27)5-3-19/h2-11H,12-18H2,1H3,(H,28,32)(H,29,33) |
| InChIKey | AVHPRZYLQWRABR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|