C26H21NO5 — CID 55375209
(2-oxo-1,2-diphenylethyl) 3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 55375209) has the molecular formula C26H21NO5 and a molecular weight of 427.46 g/mol. Its IUPAC name is (2-oxo-1,2-diphenylethyl) 3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | (2-oxo-1,2-diphenylethyl) 3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 55375209 |
| Molecular Formula | C26H21NO5 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | (2-oxo-1,2-diphenylethyl) 3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCC(=O)OC(C(=O)c1ccccc1)c1ccccc1)C2=O |
| InChI | InChI=1S/C26H21NO5/c1-17-12-13-20-21(16-17)26(31)27(25(20)30)15-14-22(28)32-24(19-10-6-3-7-11-19)23(29)18-8-4-2-5-9-18/h2-13,16,24H,14-15H2,1H3 |
| InChIKey | OEPXWDAHXBLNMH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|