C23H29ClN2O6 — CID 55383830
(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 55383830) has the molecular formula C23H29ClN2O6 and a molecular weight of 464.95 g/mol. Its IUPAC name is (6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | (6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 55383830 |
| Molecular Formula | C23H29ClN2O6 |
| Molecular Weight | 464.95 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | (6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl 2-(7,7,9-trimethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | CC1CC(C)(C)CC2(C1)NC(=O)N(CC(=O)OCc1cc(Cl)c3c(c1)OCCCO3)C2=O |
| InChI | InChI=1S/C23H29ClN2O6/c1-14-9-22(2,3)13-23(10-14)20(28)26(21(29)25-23)11-18(27)32-12-15-7-16(24)19-17(8-15)30-5-4-6-31-19/h7-8,14H,4-6,9-13H2,1-3H3,(H,25,29) |
| InChIKey | UUJDFKYRTUIJDZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.95 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|