C27H27N3O4 — CID 55384666
[2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-(2-ethylbenzimidazol-1-yl)acetate (PubChem CID 55384666) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is [2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-(2-ethylbenzimidazol-1-yl)acetate.
| Compound Name | [2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-(2-ethylbenzimidazol-1-yl)acetate |
|---|---|
| PubChem CID | 55384666 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | [2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-(2-ethylbenzimidazol-1-yl)acetate |
| SMILES | CCc1nc2ccccc2n1CC(=O)OC(C(=O)Nc1cc(C)ccc1OC)c1ccccc1 |
| InChI | InChI=1S/C27H27N3O4/c1-4-24-28-20-12-8-9-13-22(20)30(24)17-25(31)34-26(19-10-6-5-7-11-19)27(32)29-21-16-18(2)14-15-23(21)33-3/h5-16,26H,4,17H2,1-3H3,(H,29,32) |
| InChIKey | UXTOYYLANYQMJZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |