C25H23FN4O3S — CID 55387708
4-fluoro-N-(2-phenylimidazo[1,2-a]pyridin-3-yl)-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 55387708) has the molecular formula C25H23FN4O3S and a molecular weight of 478.55 g/mol. Its IUPAC name is 4-fluoro-N-(2-phenylimidazo[1,2-a]pyridin-3-yl)-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 4-fluoro-N-(2-phenylimidazo[1,2-a]pyridin-3-yl)-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55387708 |
| Molecular Formula | C25H23FN4O3S |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 4-fluoro-N-(2-phenylimidazo[1,2-a]pyridin-3-yl)-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(Nc1c(-c2ccccc2)nc2ccccn12)c1ccc(F)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C25H23FN4O3S/c26-20-13-12-19(17-21(20)34(32,33)29-14-6-2-7-15-29)25(31)28-24-23(18-9-3-1-4-10-18)27-22-11-5-8-16-30(22)24/h1,3-5,8-13,16-17H,2,6-7,14-15H2,(H,28,31) |
| InChIKey | WJSDRXMGKDSXBK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |