C26H29N5O3S — CID 55391038
2-benzyl-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 55391038) has the molecular formula C26H29N5O3S and a molecular weight of 491.62 g/mol. Its IUPAC name is 2-benzyl-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-benzyl-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 55391038 |
| Molecular Formula | C26H29N5O3S |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 2-benzyl-N-[3-[4-(2-methylpropyl)-5-methylsulfanyl-1,2,4-triazol-3-yl]propyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CSc1nnc(CCCNC(=O)c2ccc3c(c2)C(=O)N(Cc2ccccc2)C3=O)n1CC(C)C |
| InChI | InChI=1S/C26H29N5O3S/c1-17(2)15-30-22(28-29-26(30)35-3)10-7-13-27-23(32)19-11-12-20-21(14-19)25(34)31(24(20)33)16-18-8-5-4-6-9-18/h4-6,8-9,11-12,14,17H,7,10,13,15-16H2,1-3H3,(H,27,32) |
| InChIKey | UNZOAOYVSRMDPC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|