C21H18FN3O5 — CID 55391324
N-cyclopropyl-N-[(2-fluorophenyl)methyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 55391324) has the molecular formula C21H18FN3O5 and a molecular weight of 411.39 g/mol. Its IUPAC name is N-cyclopropyl-N-[(2-fluorophenyl)methyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-cyclopropyl-N-[(2-fluorophenyl)methyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 55391324 |
| Molecular Formula | C21H18FN3O5 |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | N-cyclopropyl-N-[(2-fluorophenyl)methyl]-2-(4-nitro-1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | CC(C(=O)N(Cc1ccccc1F)C1CC1)N1C(=O)c2cccc([N+](=O)[O-])c2C1=O |
| InChI | InChI=1S/C21H18FN3O5/c1-12(19(26)23(14-9-10-14)11-13-5-2-3-7-16(13)22)24-20(27)15-6-4-8-17(25(29)30)18(15)21(24)28/h2-8,12,14H,9-11H2,1H3 |
| InChIKey | LKGQFZLWRMSPJQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|