C23H24N4O7 — CID 55395775
ethyl 4-[(5-ethoxy-4-methoxy-2-nitrobenzoyl)amino]-2-methyl-1H-1,5-benzodiazepine-3-carboxylate (PubChem CID 55395775) has the molecular formula C23H24N4O7 and a molecular weight of 468.47 g/mol. Its IUPAC name is ethyl 4-[(5-ethoxy-4-methoxy-2-nitrobenzoyl)amino]-2-methyl-1H-1,5-benzodiazepine-3-carboxylate.
| Compound Name | ethyl 4-[(5-ethoxy-4-methoxy-2-nitrobenzoyl)amino]-2-methyl-1H-1,5-benzodiazepine-3-carboxylate |
|---|---|
| PubChem CID | 55395775 |
| Molecular Formula | C23H24N4O7 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | ethyl 4-[(5-ethoxy-4-methoxy-2-nitrobenzoyl)amino]-2-methyl-1H-1,5-benzodiazepine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Nc2ccccc2N=C1NC(=O)c1cc(OCC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H24N4O7/c1-5-33-19-11-14(17(27(30)31)12-18(19)32-4)22(28)26-21-20(23(29)34-6-2)13(3)24-15-9-7-8-10-16(15)25-21/h7-12,24H,5-6H2,1-4H3,(H,25,26,28) |
| InChIKey | XZYZJSPONBIIEE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 141.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|