C20H19N5O6 — CID 55412268
6-amino-1-benzyl-3-ethyl-5-[2-(5-nitro-2-oxo-1-pyridinyl)acetyl]pyrimidine-2,4-dione (PubChem CID 55412268) has the molecular formula C20H19N5O6 and a molecular weight of 425.40 g/mol. Its IUPAC name is 6-amino-1-benzyl-3-ethyl-5-[2-(5-nitro-2-oxo-1-pyridinyl)acetyl]pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-benzyl-3-ethyl-5-[2-(5-nitro-2-oxo-1-pyridinyl)acetyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 55412268 |
| Molecular Formula | C20H19N5O6 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 6-amino-1-benzyl-3-ethyl-5-[2-(5-nitro-2-oxo-1-pyridinyl)acetyl]pyrimidine-2,4-dione |
| SMILES | CCn1c(=O)c(C(=O)Cn2cc([N+](=O)[O-])ccc2=O)c(N)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C20H19N5O6/c1-2-23-19(28)17(15(26)12-22-11-14(25(30)31)8-9-16(22)27)18(21)24(20(23)29)10-13-6-4-3-5-7-13/h3-9,11H,2,10,12,21H2,1H3 |
| InChIKey | NRIVXHSDJKDXEP-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 152.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|