C22H21N5O8 — CID 55667680
methyl 1-[2-(6-amino-1-benzyl-3-ethyl-2,4-dioxopyrimidin-5-yl)-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate (PubChem CID 55667680) has the molecular formula C22H21N5O8 and a molecular weight of 483.44 g/mol. Its IUPAC name is methyl 1-[2-(6-amino-1-benzyl-3-ethyl-2,4-dioxopyrimidin-5-yl)-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate.
| Compound Name | methyl 1-[2-(6-amino-1-benzyl-3-ethyl-2,4-dioxopyrimidin-5-yl)-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate |
|---|---|
| PubChem CID | 55667680 |
| Molecular Formula | C22H21N5O8 |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | methyl 1-[2-(6-amino-1-benzyl-3-ethyl-2,4-dioxopyrimidin-5-yl)-2-oxoethyl]-5-nitro-6-oxopyridine-3-carboxylate |
| SMILES | CCn1c(=O)c(C(=O)Cn2cc(C(=O)OC)cc([N+](=O)[O-])c2=O)c(N)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C22H21N5O8/c1-3-25-20(30)17(18(23)26(22(25)32)10-13-7-5-4-6-8-13)16(28)12-24-11-14(21(31)35-2)9-15(19(24)29)27(33)34/h4-9,11H,3,10,12,23H2,1-2H3 |
| InChIKey | NFIKADSXYHTILM-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 178.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|