C20H21F2N3O4 — CID 55412776
2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]acetamide (PubChem CID 55412776) has the molecular formula C20H21F2N3O4 and a molecular weight of 405.40 g/mol. Its IUPAC name is 2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]acetamide.
| Compound Name | 2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]acetamide |
|---|---|
| PubChem CID | 55412776 |
| Molecular Formula | C20H21F2N3O4 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-N-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CNC(=O)CNc2ccc3c(c2)OC(F)(F)O3)c(C)c1 |
| InChI | InChI=1S/C20H21F2N3O4/c1-11-6-12(2)19(13(3)7-11)25-18(27)10-24-17(26)9-23-14-4-5-15-16(8-14)29-20(21,22)28-15/h4-8,23H,9-10H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | FAWPTJKCENVPNC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|