C26H21F2N3O3S — CID 55418096
[1-(2,6-difluoroanilino)-1-oxopropan-2-yl] (E)-3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate (PubChem CID 55418096) has the molecular formula C26H21F2N3O3S and a molecular weight of 493.54 g/mol. Its IUPAC name is [1-(2,6-difluoroanilino)-1-oxopropan-2-yl] (E)-3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate.
| Compound Name | [1-(2,6-difluoroanilino)-1-oxopropan-2-yl] (E)-3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 55418096 |
| Molecular Formula | C26H21F2N3O3S |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | [1-(2,6-difluoroanilino)-1-oxopropan-2-yl] (E)-3-(1-benzyl-3-thiophen-2-ylpyrazol-4-yl)prop-2-enoate |
| SMILES | CC(OC(=O)/C=C/c1cn(Cc2ccccc2)nc1-c1cccs1)C(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C26H21F2N3O3S/c1-17(26(33)29-25-20(27)9-5-10-21(25)28)34-23(32)13-12-19-16-31(15-18-7-3-2-4-8-18)30-24(19)22-11-6-14-35-22/h2-14,16-17H,15H2,1H3,(H,29,33)/b13-12+ |
| InChIKey | NYARYDGEXSUXEM-OUKQBFOZSA-N |
| XLogP | 5.52 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|