C25H27N3O3 — CID 8913846
[(2R)-1-(ethylamino)-1-oxopropan-2-yl] (E)-3-[1-[(4-methylphenyl)methyl]-3-phenylpyrazol-4-yl]prop-2-enoate (PubChem CID 8913846) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is [(2R)-1-(ethylamino)-1-oxopropan-2-yl] (E)-3-[1-[(4-methylphenyl)methyl]-3-phenylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [(2R)-1-(ethylamino)-1-oxopropan-2-yl] (E)-3-[1-[(4-methylphenyl)methyl]-3-phenylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 8913846 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | [(2R)-1-(ethylamino)-1-oxopropan-2-yl] (E)-3-[1-[(4-methylphenyl)methyl]-3-phenylpyrazol-4-yl]prop-2-enoate |
| SMILES | CCNC(=O)[C@@H](C)OC(=O)/C=C/c1cn(Cc2ccc(C)cc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C25H27N3O3/c1-4-26-25(30)19(3)31-23(29)15-14-22-17-28(16-20-12-10-18(2)11-13-20)27-24(22)21-8-6-5-7-9-21/h5-15,17,19H,4,16H2,1-3H3,(H,26,30)/b15-14+/t19-/m1/s1 |
| InChIKey | FJPYUWAIXGJLPM-JUWJPQTCSA-N |
| XLogP | 3.99 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|