C18H17F3N2O3S2 — CID 55428463
1-(4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylethanone (PubChem CID 55428463) has the molecular formula C18H17F3N2O3S2 and a molecular weight of 430.47 g/mol. Its IUPAC name is 1-(4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylethanone.
| Compound Name | 1-(4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylethanone |
|---|---|
| PubChem CID | 55428463 |
| Molecular Formula | C18H17F3N2O3S2 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 1-(4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylethanone |
| SMILES | CCC1c2ccsc2CCN1C(=O)CSc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H17F3N2O3S2/c1-2-13-12-6-8-27-15(12)5-7-22(13)17(24)10-28-16-4-3-11(18(19,20)21)9-14(16)23(25)26/h3-4,6,8-9,13H,2,5,7,10H2,1H3 |
| InChIKey | XFBNRWHQFUGZQJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|