C19H21ClN2O3S2 — CID 55434537
1-acetyl-N-[(5-chlorothiophen-2-yl)methyl]-N-prop-2-enyl-3,4-dihydro-2H-quinoline-6-sulfonamide (PubChem CID 55434537) has the molecular formula C19H21ClN2O3S2 and a molecular weight of 424.98 g/mol. Its IUPAC name is 1-acetyl-N-[(5-chlorothiophen-2-yl)methyl]-N-prop-2-enyl-3,4-dihydro-2H-quinoline-6-sulfonamide.
| Compound Name | 1-acetyl-N-[(5-chlorothiophen-2-yl)methyl]-N-prop-2-enyl-3,4-dihydro-2H-quinoline-6-sulfonamide |
|---|---|
| PubChem CID | 55434537 |
| Molecular Formula | C19H21ClN2O3S2 |
| Molecular Weight | 424.98 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 1-acetyl-N-[(5-chlorothiophen-2-yl)methyl]-N-prop-2-enyl-3,4-dihydro-2H-quinoline-6-sulfonamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)S(=O)(=O)c1ccc2c(c1)CCCN2C(C)=O |
| InChI | InChI=1S/C19H21ClN2O3S2/c1-3-10-21(13-16-6-9-19(20)26-16)27(24,25)17-7-8-18-15(12-17)5-4-11-22(18)14(2)23/h3,6-9,12H,1,4-5,10-11,13H2,2H3 |
| InChIKey | ROQYBGNAAMSWJG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.98 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|