C20H28N4O5S — CID 55438514
N,N-diethyl-1-[4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoyl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 55438514) has the molecular formula C20H28N4O5S and a molecular weight of 436.53 g/mol. Its IUPAC name is N,N-diethyl-1-[4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoyl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | N,N-diethyl-1-[4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoyl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 55438514 |
| Molecular Formula | C20H28N4O5S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | N,N-diethyl-1-[4-(3-methyl-2,5-dioxoimidazolidin-1-yl)butanoyl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2c(c1)CCN2C(=O)CCCN1C(=O)CN(C)C1=O |
| InChI | InChI=1S/C20H28N4O5S/c1-4-22(5-2)30(28,29)16-8-9-17-15(13-16)10-12-23(17)18(25)7-6-11-24-19(26)14-21(3)20(24)27/h8-9,13H,4-7,10-12,14H2,1-3H3 |
| InChIKey | QPEXJODZNNISJP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 98.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|