C20H20N2O5S — CID 55448496
[2-[5-(2-acetamidoethyl)thiophen-2-yl]-2-oxoethyl] 2-(4-cyanophenoxy)propanoate (PubChem CID 55448496) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is [2-[5-(2-acetamidoethyl)thiophen-2-yl]-2-oxoethyl] 2-(4-cyanophenoxy)propanoate.
| Compound Name | [2-[5-(2-acetamidoethyl)thiophen-2-yl]-2-oxoethyl] 2-(4-cyanophenoxy)propanoate |
|---|---|
| PubChem CID | 55448496 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | [2-[5-(2-acetamidoethyl)thiophen-2-yl]-2-oxoethyl] 2-(4-cyanophenoxy)propanoate |
| SMILES | CC(=O)NCCc1ccc(C(=O)COC(=O)C(C)Oc2ccc(C#N)cc2)s1 |
| InChI | InChI=1S/C20H20N2O5S/c1-13(27-16-5-3-15(11-21)4-6-16)20(25)26-12-18(24)19-8-7-17(28-19)9-10-22-14(2)23/h3-8,13H,9-10,12H2,1-2H3,(H,22,23) |
| InChIKey | RAHRFAFZITXPQK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |