C17H18N2O7S — CID 55449910
[2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate (PubChem CID 55449910) has the molecular formula C17H18N2O7S and a molecular weight of 394.41 g/mol. Its IUPAC name is [2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate.
| Compound Name | [2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate |
|---|---|
| PubChem CID | 55449910 |
| Molecular Formula | C17H18N2O7S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | [2-(6-nitro-3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl] 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)acetate |
| SMILES | O=C(CC1C=CS(=O)(=O)C1)OCC(=O)N1CCCc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C17H18N2O7S/c20-16(10-26-17(21)8-12-5-7-27(24,25)11-12)18-6-1-2-13-9-14(19(22)23)3-4-15(13)18/h3-5,7,9,12H,1-2,6,8,10-11H2 |
| InChIKey | WQFCYJJFAGPWEJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|