C14H14N2O5S — CID 75866642
2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone (PubChem CID 75866642) has the molecular formula C14H14N2O5S and a molecular weight of 322.34 g/mol. Its IUPAC name is 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 75866642 |
| Molecular Formula | C14H14N2O5S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 2-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1-(6-nitro-2,3-dihydroindol-1-yl)ethanone |
| SMILES | O=C(CC1C=CS(=O)(=O)C1)N1CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C14H14N2O5S/c17-14(7-10-4-6-22(20,21)9-10)15-5-3-11-1-2-12(16(18)19)8-13(11)15/h1-2,4,6,8,10H,3,5,7,9H2 |
| InChIKey | VCIJWGWIJASWQC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|