C20H23NO7S — CID 55459429
methyl 3-[3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoyloxymethyl]furan-2-carboxylate (PubChem CID 55459429) has the molecular formula C20H23NO7S and a molecular weight of 421.47 g/mol. Its IUPAC name is methyl 3-[3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoyloxymethyl]furan-2-carboxylate.
| Compound Name | methyl 3-[3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoyloxymethyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 55459429 |
| Molecular Formula | C20H23NO7S |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | methyl 3-[3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoyloxymethyl]furan-2-carboxylate |
| SMILES | COC(=O)c1occc1COC(=O)CCc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C20H23NO7S/c1-26-20(23)19-16(10-13-27-19)14-28-18(22)9-6-15-4-7-17(8-5-15)29(24,25)21-11-2-3-12-21/h4-5,7-8,10,13H,2-3,6,9,11-12,14H2,1H3 |
| InChIKey | LWKWUNZOADTPJF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |