C21H18N2O2S — CID 55460514
N-[2-(2,3-dihydro-1H-inden-1-ylcarbamoyl)phenyl]thiophene-3-carboxamide (PubChem CID 55460514) has the molecular formula C21H18N2O2S and a molecular weight of 362.45 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1H-inden-1-ylcarbamoyl)phenyl]thiophene-3-carboxamide.
| Compound Name | N-[2-(2,3-dihydro-1H-inden-1-ylcarbamoyl)phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 55460514 |
| Molecular Formula | C21H18N2O2S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | N-[2-(2,3-dihydro-1H-inden-1-ylcarbamoyl)phenyl]thiophene-3-carboxamide |
| SMILES | O=C(Nc1ccccc1C(=O)NC1CCc2ccccc21)c1ccsc1 |
| InChI | InChI=1S/C21H18N2O2S/c24-20(15-11-12-26-13-15)22-18-8-4-3-7-17(18)21(25)23-19-10-9-14-5-1-2-6-16(14)19/h1-8,11-13,19H,9-10H2,(H,22,24)(H,23,25) |
| InChIKey | KSYDHVNDFZUUAJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |