C27H28N4O2S — CID 55461112
N-[3-(1H-benzimidazol-2-yl)propyl]-1-(4-methylphenyl)-6-oxo-2-thiophen-2-ylpiperidine-3-carboxamide (PubChem CID 55461112) has the molecular formula C27H28N4O2S and a molecular weight of 472.61 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)propyl]-1-(4-methylphenyl)-6-oxo-2-thiophen-2-ylpiperidine-3-carboxamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)propyl]-1-(4-methylphenyl)-6-oxo-2-thiophen-2-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 55461112 |
| Molecular Formula | C27H28N4O2S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)propyl]-1-(4-methylphenyl)-6-oxo-2-thiophen-2-ylpiperidine-3-carboxamide |
| SMILES | Cc1ccc(N2C(=O)CCC(C(=O)NCCCc3nc4ccccc4[nH]3)C2c2cccs2)cc1 |
| InChI | InChI=1S/C27H28N4O2S/c1-18-10-12-19(13-11-18)31-25(32)15-14-20(26(31)23-8-5-17-34-23)27(33)28-16-4-9-24-29-21-6-2-3-7-22(21)30-24/h2-3,5-8,10-13,17,20,26H,4,9,14-16H2,1H3,(H,28,33)(H,29,30) |
| InChIKey | YQUKSICFEKKXBV-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|