C23H25N5O4S — CID 55461466
2-[4-[4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzoyl]piperazin-1-yl]-N-prop-2-enylacetamide (PubChem CID 55461466) has the molecular formula C23H25N5O4S and a molecular weight of 467.55 g/mol. Its IUPAC name is 2-[4-[4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzoyl]piperazin-1-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[4-[4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzoyl]piperazin-1-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 55461466 |
| Molecular Formula | C23H25N5O4S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 2-[4-[4-[(1,1-dioxo-1,2-benzothiazol-3-yl)amino]benzoyl]piperazin-1-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CN1CCN(C(=O)c2ccc(NC3=NS(=O)(=O)c4ccccc43)cc2)CC1 |
| InChI | InChI=1S/C23H25N5O4S/c1-2-11-24-21(29)16-27-12-14-28(15-13-27)23(30)17-7-9-18(10-8-17)25-22-19-5-3-4-6-20(19)33(31,32)26-22/h2-10H,1,11-16H2,(H,24,29)(H,25,26) |
| InChIKey | SPHCJHSNCLRBPM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|