C24H29N3O5 — CID 55462594
(E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-[(4-benzylmorpholin-2-yl)methyl]prop-2-enamide (PubChem CID 55462594) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-[(4-benzylmorpholin-2-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-[(4-benzylmorpholin-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 55462594 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-[(4-benzylmorpholin-2-yl)methyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCC2CN(Cc3ccccc3)CCO2)ccc1OCC(N)=O |
| InChI | InChI=1S/C24H29N3O5/c1-30-22-13-18(7-9-21(22)32-17-23(25)28)8-10-24(29)26-14-20-16-27(11-12-31-20)15-19-5-3-2-4-6-19/h2-10,13,20H,11-12,14-17H2,1H3,(H2,25,28)(H,26,29)/b10-8+ |
| InChIKey | FMZZLBACJCYZFC-CSKARUKUSA-N |
| XLogP | 1.59 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|