C22H22N4O4 — CID 55432950
(E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-(2-benzylpyrazol-3-yl)prop-2-enamide (PubChem CID 55432950) has the molecular formula C22H22N4O4 and a molecular weight of 406.44 g/mol. Its IUPAC name is (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-(2-benzylpyrazol-3-yl)prop-2-enamide.
| Compound Name | (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-(2-benzylpyrazol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55432950 |
| Molecular Formula | C22H22N4O4 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-(2-benzylpyrazol-3-yl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccnn2Cc2ccccc2)ccc1OCC(N)=O |
| InChI | InChI=1S/C22H22N4O4/c1-29-19-13-16(7-9-18(19)30-15-20(23)27)8-10-22(28)25-21-11-12-24-26(21)14-17-5-3-2-4-6-17/h2-13H,14-15H2,1H3,(H2,23,27)(H,25,28)/b10-8+ |
| InChIKey | NYLNJILXMXGNJP-CSKARUKUSA-N |
| XLogP | 2.46 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|