C26H26N2O4 — CID 56523661
(E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-(1,1-diphenylethyl)prop-2-enamide (PubChem CID 56523661) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-(1,1-diphenylethyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-(1,1-diphenylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 56523661 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-(1,1-diphenylethyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NC(C)(c2ccccc2)c2ccccc2)ccc1OCC(N)=O |
| InChI | InChI=1S/C26H26N2O4/c1-26(20-9-5-3-6-10-20,21-11-7-4-8-12-21)28-25(30)16-14-19-13-15-22(23(17-19)31-2)32-18-24(27)29/h3-17H,18H2,1-2H3,(H2,27,29)(H,28,30)/b16-14+ |
| InChIKey | GPISJHQRAPTRHO-JQIJEIRASA-N |
| XLogP | 3.65 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|