C25H22N2O5 — CID 56547609
(E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-(9H-xanthen-9-yl)prop-2-enamide (PubChem CID 56547609) has the molecular formula C25H22N2O5 and a molecular weight of 430.46 g/mol. Its IUPAC name is (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-(9H-xanthen-9-yl)prop-2-enamide.
| Compound Name | (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-(9H-xanthen-9-yl)prop-2-enamide |
|---|---|
| PubChem CID | 56547609 |
| Molecular Formula | C25H22N2O5 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-(9H-xanthen-9-yl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NC2c3ccccc3Oc3ccccc32)ccc1OCC(N)=O |
| InChI | InChI=1S/C25H22N2O5/c1-30-22-14-16(10-12-21(22)31-15-23(26)28)11-13-24(29)27-25-17-6-2-4-8-19(17)32-20-9-5-3-7-18(20)25/h2-14,25H,15H2,1H3,(H2,26,28)(H,27,29)/b13-11+ |
| InChIKey | WMMFVSIECJOPQA-ACCUITESSA-N |
| XLogP | 3.58 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|