C19H21NO7S — CID 55474921
[2-(2-methylmorpholin-4-yl)-2-oxoethyl] 5-(benzenesulfonylmethyl)furan-2-carboxylate (PubChem CID 55474921) has the molecular formula C19H21NO7S and a molecular weight of 407.44 g/mol. Its IUPAC name is [2-(2-methylmorpholin-4-yl)-2-oxoethyl] 5-(benzenesulfonylmethyl)furan-2-carboxylate.
| Compound Name | [2-(2-methylmorpholin-4-yl)-2-oxoethyl] 5-(benzenesulfonylmethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 55474921 |
| Molecular Formula | C19H21NO7S |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | [2-(2-methylmorpholin-4-yl)-2-oxoethyl] 5-(benzenesulfonylmethyl)furan-2-carboxylate |
| SMILES | CC1CN(C(=O)COC(=O)c2ccc(CS(=O)(=O)c3ccccc3)o2)CCO1 |
| InChI | InChI=1S/C19H21NO7S/c1-14-11-20(9-10-25-14)18(21)12-26-19(22)17-8-7-15(27-17)13-28(23,24)16-5-3-2-4-6-16/h2-8,14H,9-13H2,1H3 |
| InChIKey | JEFKBBBIVDBRCK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |