C21H26N4O6S2 — CID 55480502
N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-(4-methyl-2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl)acetamide (PubChem CID 55480502) has the molecular formula C21H26N4O6S2 and a molecular weight of 494.60 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-(4-methyl-2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl)acetamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-(4-methyl-2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 55480502 |
| Molecular Formula | C21H26N4O6S2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-(4-methyl-2,5-dioxo-4-thiophen-2-ylimidazolidin-1-yl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC)c(NC(=O)CN2C(=O)NC(C)(c3cccs3)C2=O)c1 |
| InChI | InChI=1S/C21H26N4O6S2/c1-5-24(6-2)33(29,30)14-9-10-16(31-4)15(12-14)22-18(26)13-25-19(27)21(3,23-20(25)28)17-8-7-11-32-17/h7-12H,5-6,13H2,1-4H3,(H,22,26)(H,23,28) |
| InChIKey | DBZXFTIWQGUDLH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|