C22H21N3O4S3 — CID 55498504
N-[2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetamide (PubChem CID 55498504) has the molecular formula C22H21N3O4S3 and a molecular weight of 487.63 g/mol. Its IUPAC name is N-[2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetamide.
| Compound Name | N-[2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetamide |
|---|---|
| PubChem CID | 55498504 |
| Molecular Formula | C22H21N3O4S3 |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | N-[2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl]-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetamide |
| SMILES | O=C(CN1CCc2sccc2C1)NCCN1C(=O)/C(=C\c2ccc3c(c2)OCO3)SC1=S |
| InChI | InChI=1S/C22H21N3O4S3/c26-20(12-24-6-3-18-15(11-24)4-8-31-18)23-5-7-25-21(27)19(32-22(25)30)10-14-1-2-16-17(9-14)29-13-28-16/h1-2,4,8-10H,3,5-7,11-13H2,(H,23,26)/b19-10+ |
| InChIKey | LUMUCYJMANMTGA-VXLYETTFSA-N |
| XLogP | 2.85 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|