C21H32N6O6S — CID 55498703
2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-[4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 55498703) has the molecular formula C21H32N6O6S and a molecular weight of 496.59 g/mol. Its IUPAC name is 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-[4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-[4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 55498703 |
| Molecular Formula | C21H32N6O6S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 2-[4-(diethylsulfamoyl)piperazin-1-yl]-N-[4-(3-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCN(CC(=O)NN2C(=O)NC(C)(c3cccc(OC)c3)C2=O)CC1 |
| InChI | InChI=1S/C21H32N6O6S/c1-5-25(6-2)34(31,32)26-12-10-24(11-13-26)15-18(28)23-27-19(29)21(3,22-20(27)30)16-8-7-9-17(14-16)33-4/h7-9,14H,5-6,10-13,15H2,1-4H3,(H,22,30)(H,23,28) |
| InChIKey | LIYQDPLZBBDNMN-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 131.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|