C23H34N6O6 — CID 24568484
2-[4-[2-[[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]amino]-2-oxoethyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide (PubChem CID 24568484) has the molecular formula C23H34N6O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is 2-[4-[2-[[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]amino]-2-oxoethyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[4-[2-[[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]amino]-2-oxoethyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 24568484 |
| Molecular Formula | C23H34N6O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 2-[4-[2-[[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]amino]-2-oxoethyl]piperazin-1-yl]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CN1CCN(CC(=O)NN2C(=O)NC(C)(c3ccc(OC)cc3)C2=O)CC1 |
| InChI | InChI=1S/C23H34N6O6/c1-23(17-5-7-18(35-3)8-6-17)21(32)29(22(33)25-23)26-20(31)16-28-12-10-27(11-13-28)15-19(30)24-9-4-14-34-2/h5-8H,4,9-16H2,1-3H3,(H,24,30)(H,25,33)(H,26,31) |
| InChIKey | KGMVKSOOXRAGPQ-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 132.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|