C26H30N2O5 — CID 55504752
N-(1,3-benzodioxol-5-ylmethyl)-2-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)acetamide (PubChem CID 55504752) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)acetamide |
|---|---|
| PubChem CID | 55504752 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)acetamide |
| SMILES | CC1c2cc3c(cc2C2(CCCC2)CN1CC(=O)NCc1ccc2c(c1)OCO2)OCCO3 |
| InChI | InChI=1S/C26H30N2O5/c1-17-19-11-23-24(31-9-8-30-23)12-20(19)26(6-2-3-7-26)15-28(17)14-25(29)27-13-18-4-5-21-22(10-18)33-16-32-21/h4-5,10-12,17H,2-3,6-9,13-16H2,1H3,(H,27,29) |
| InChIKey | DTBQJIJUAMHONR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |