C29H37N3O4 — CID 46508834
N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methyl-2-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)acetamide (PubChem CID 46508834) has the molecular formula C29H37N3O4 and a molecular weight of 491.63 g/mol. Its IUPAC name is N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methyl-2-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)acetamide.
| Compound Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methyl-2-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)acetamide |
|---|---|
| PubChem CID | 46508834 |
| Molecular Formula | C29H37N3O4 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | N-[2-(2,6-dimethylanilino)-2-oxoethyl]-N-methyl-2-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN(C)C(=O)CN1CC2(CCCC2)c2cc3c(cc2C1C)OCCO3 |
| InChI | InChI=1S/C29H37N3O4/c1-19-8-7-9-20(2)28(19)30-26(33)16-31(4)27(34)17-32-18-29(10-5-6-11-29)23-15-25-24(35-12-13-36-25)14-22(23)21(32)3/h7-9,14-15,21H,5-6,10-13,16-18H2,1-4H3,(H,30,33) |
| InChIKey | HPPUNXIMIWRLKF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |