C26H31N3O4 — CID 167774854
N-[4-(dimethylcarbamoyl)phenyl]-6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-carboxamide (PubChem CID 167774854) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is N-[4-(dimethylcarbamoyl)phenyl]-6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-carboxamide.
| Compound Name | N-[4-(dimethylcarbamoyl)phenyl]-6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-carboxamide |
|---|---|
| PubChem CID | 167774854 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | N-[4-(dimethylcarbamoyl)phenyl]-6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-carboxamide |
| SMILES | CC1c2cc3c(cc2C2(CCCC2)CN1C(=O)Nc1ccc(C(=O)N(C)C)cc1)OCCO3 |
| InChI | InChI=1S/C26H31N3O4/c1-17-20-14-22-23(33-13-12-32-22)15-21(20)26(10-4-5-11-26)16-29(17)25(31)27-19-8-6-18(7-9-19)24(30)28(2)3/h6-9,14-15,17H,4-5,10-13,16H2,1-3H3,(H,27,31) |
| InChIKey | CSHBGRNOLBGCHP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |